About 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine
2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine (PubChem CID 121204966) has the molecular formula C8H11F2N3O
and a molecular weight of 203.19 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine |
| PubChem CID | 121204966 |
| Molecular Formula | C8H11F2N3O |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine |
| SMILES | Cc1nc(OCC(F)F)nc(C)c1N |
| InChI | InChI=1S/C8H11F2N3O/c1-4-7(11)5(2)13-8(12-4)14-3-6(9)10/h6H,3,11H2,1-2H3 |
| InChIKey | CNAFADIXCOPWNJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine?
The IUPAC name of 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine (CID 121204966) is 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine.
What is the SMILES notation for 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine?
The canonical SMILES for 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine is Cc1nc(OCC(F)F)nc(C)c1N.
What is the InChIKey of 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine?
The InChIKey is CNAFADIXCOPWNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3O/c1-4-7(11)5(2)13-8(12-4)14-3-6(9)10/h6H,3,11H2,1-2H3.
What are the key properties of 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine?
2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine has a molecular weight of 203.19 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethoxy)-4,6-dimethylpyrimidin-5-amine is sourced from PubChem (CID 121204966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).