About 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile
5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile (PubChem CID 121205126) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile.
Molecular Properties
| Compound Name | 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile |
| PubChem CID | 121205126 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile |
| SMILES | Cc1ccc(C)c(-c2cnc(C#N)o2)c1 |
| InChI | InChI=1S/C12H10N2O/c1-8-3-4-9(2)10(5-8)11-7-14-12(6-13)15-11/h3-5,7H,1-2H3 |
| InChIKey | JFHAQODCMSSZLL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile?
The IUPAC name of 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile (CID 121205126) is 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile.
What is the SMILES notation for 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile?
The canonical SMILES for 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile is Cc1ccc(C)c(-c2cnc(C#N)o2)c1.
What is the InChIKey of 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile?
The InChIKey is JFHAQODCMSSZLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c1-8-3-4-9(2)10(5-8)11-7-14-12(6-13)15-11/h3-5,7H,1-2H3.
What are the key properties of 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile?
5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile has a molecular weight of 198.22 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dimethylphenyl)-1,3-oxazole-2-carbonitrile is sourced from PubChem (CID 121205126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).