C8H12N4O — CID 121206025
1-[6-(methylamino)pyrimidin-4-yl]azetidin-3-ol (PubChem CID 121206025) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-[6-(methylamino)pyrimidin-4-yl]azetidin-3-ol.
| Compound Name | 1-[6-(methylamino)pyrimidin-4-yl]azetidin-3-ol |
|---|---|
| PubChem CID | 121206025 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1-[6-(methylamino)pyrimidin-4-yl]azetidin-3-ol |
| SMILES | CNc1cc(N2CC(O)C2)ncn1 |
| InChI | InChI=1S/C8H12N4O/c1-9-7-2-8(11-5-10-7)12-3-6(13)4-12/h2,5-6,13H,3-4H2,1H3,(H,9,10,11) |
| InChIKey | MFYRSCZVYQKOJY-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |