C10H18N4O2 — CID 121206030
4-N-(2,2-dimethoxyethyl)-6-N,2-dimethylpyrimidine-4,6-diamine (PubChem CID 121206030) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-N-(2,2-dimethoxyethyl)-6-N,2-dimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,2-dimethoxyethyl)-6-N,2-dimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 121206030 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 4-N-(2,2-dimethoxyethyl)-6-N,2-dimethylpyrimidine-4,6-diamine |
| SMILES | CNc1cc(NCC(OC)OC)nc(C)n1 |
| InChI | InChI=1S/C10H18N4O2/c1-7-13-8(11-2)5-9(14-7)12-6-10(15-3)16-4/h5,10H,6H2,1-4H3,(H2,11,12,13,14) |
| InChIKey | MQSRQJXLFWNNQY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|