About 6-azaspiro[3.4]octane-2,5-dione
6-azaspiro[3.4]octane-2,5-dione (PubChem CID 121207147) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 6-azaspiro[3.4]octane-2,5-dione.
Molecular Properties
| Compound Name | 6-azaspiro[3.4]octane-2,5-dione |
| PubChem CID | 121207147 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 6-azaspiro[3.4]octane-2,5-dione |
| SMILES | O=C1CC2(CCNC2=O)C1 |
| InChI | InChI=1S/C7H9NO2/c9-5-3-7(4-5)1-2-8-6(7)10/h1-4H2,(H,8,10) |
| InChIKey | UZZSKGIHKCJBDB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-azaspiro[3.4]octane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azaspiro[3.4]octane-2,5-dione?
The IUPAC name of 6-azaspiro[3.4]octane-2,5-dione (CID 121207147) is 6-azaspiro[3.4]octane-2,5-dione.
What is the SMILES notation for 6-azaspiro[3.4]octane-2,5-dione?
The canonical SMILES for 6-azaspiro[3.4]octane-2,5-dione is O=C1CC2(CCNC2=O)C1.
What is the InChIKey of 6-azaspiro[3.4]octane-2,5-dione?
The InChIKey is UZZSKGIHKCJBDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c9-5-3-7(4-5)1-2-8-6(7)10/h1-4H2,(H,8,10).
What are the key properties of 6-azaspiro[3.4]octane-2,5-dione?
6-azaspiro[3.4]octane-2,5-dione has a molecular weight of 139.15 g/mol, XLogP of -0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azaspiro[3.4]octane-2,5-dione is sourced from PubChem (CID 121207147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).