C10H16N2 — CID 121207240
3-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)prop-2-yn-1-amine (PubChem CID 121207240) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 3-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)prop-2-yn-1-amine.
| Compound Name | 3-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 121207240 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 3-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)prop-2-yn-1-amine |
| SMILES | NCC#CC12CCCN1CCC2 |
| InChI | InChI=1S/C10H16N2/c11-7-1-4-10-5-2-8-12(10)9-3-6-10/h2-3,5-9,11H2 |
| InChIKey | KAYOAVHCNUKTBB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|