About spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one
spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one (PubChem CID 121207247) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one.
Molecular Properties
| Compound Name | spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one |
| PubChem CID | 121207247 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one |
| SMILES | O=C1NCCC2(CC3CCC(C2)N3)O1 |
| InChI | InChI=1S/C10H16N2O2/c13-9-11-4-3-10(14-9)5-7-1-2-8(6-10)12-7/h7-8,12H,1-6H2,(H,11,13) |
| InChIKey | LDTSIAMZQLCOFX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one?
The IUPAC name of spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one (CID 121207247) is spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one.
What is the SMILES notation for spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one?
The canonical SMILES for spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one is O=C1NCCC2(CC3CCC(C2)N3)O1.
What is the InChIKey of spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one?
The InChIKey is LDTSIAMZQLCOFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c13-9-11-4-3-10(14-9)5-7-1-2-8(6-10)12-7/h7-8,12H,1-6H2,(H,11,13).
What are the key properties of spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one?
spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one has a molecular weight of 196.25 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-oxazinane-6,3'-8-azabicyclo[3.2.1]octane]-2-one is sourced from PubChem (CID 121207247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).