About 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one
9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one (PubChem CID 121207723) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one.
Molecular Properties
| Compound Name | 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one |
| PubChem CID | 121207723 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one |
| SMILES | CN1Cc2cccc(O)c2OCC1=O |
| InChI | InChI=1S/C10H11NO3/c1-11-5-7-3-2-4-8(12)10(7)14-6-9(11)13/h2-4,12H,5-6H2,1H3 |
| InChIKey | IJJWUBGSIDYTIS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one?
The IUPAC name of 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one (CID 121207723) is 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one.
What is the SMILES notation for 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one?
The canonical SMILES for 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one is CN1Cc2cccc(O)c2OCC1=O.
What is the InChIKey of 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one?
The InChIKey is IJJWUBGSIDYTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-11-5-7-3-2-4-8(12)10(7)14-6-9(11)13/h2-4,12H,5-6H2,1H3.
What are the key properties of 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one?
9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one has a molecular weight of 193.20 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-4-methyl-5H-1,4-benzoxazepin-3-one is sourced from PubChem (CID 121207723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).