About 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one
3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one (PubChem CID 121207755) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one.
Molecular Properties
| Compound Name | 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one |
| PubChem CID | 121207755 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one |
| SMILES | CN(C)c1nnc(C2CC(=O)C2)o1 |
| InChI | InChI=1S/C8H11N3O2/c1-11(2)8-10-9-7(13-8)5-3-6(12)4-5/h5H,3-4H2,1-2H3 |
| InChIKey | QCMGYMIPKNHGMP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one?
The IUPAC name of 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one (CID 121207755) is 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one.
What is the SMILES notation for 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one?
The canonical SMILES for 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one is CN(C)c1nnc(C2CC(=O)C2)o1.
What is the InChIKey of 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one?
The InChIKey is QCMGYMIPKNHGMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-11(2)8-10-9-7(13-8)5-3-6(12)4-5/h5H,3-4H2,1-2H3.
What are the key properties of 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one?
3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one has a molecular weight of 181.19 g/mol, XLogP of 0.58, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(dimethylamino)-1,3,4-oxadiazol-2-yl]cyclobutan-1-one is sourced from PubChem (CID 121207755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).