C11H13NO3 — CID 121208404
2-oxo-1-(oxolan-3-ylmethyl)pyridine-3-carbaldehyde (PubChem CID 121208404) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-oxo-1-(oxolan-3-ylmethyl)pyridine-3-carbaldehyde.
| Compound Name | 2-oxo-1-(oxolan-3-ylmethyl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 121208404 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-oxo-1-(oxolan-3-ylmethyl)pyridine-3-carbaldehyde |
| SMILES | O=Cc1cccn(CC2CCOC2)c1=O |
| InChI | InChI=1S/C11H13NO3/c13-7-10-2-1-4-12(11(10)14)6-9-3-5-15-8-9/h1-2,4,7,9H,3,5-6,8H2 |
| InChIKey | YOUYGIRYRDYLBM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|