C13H15N3 — CID 121209051
3-phenyl-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepine (PubChem CID 121209051) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-phenyl-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepine.
| Compound Name | 3-phenyl-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepine |
|---|---|
| PubChem CID | 121209051 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-phenyl-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepine |
| SMILES | c1ccc(-c2n[nH]c3c2CCNCC3)cc1 |
| InChI | InChI=1S/C13H15N3/c1-2-4-10(5-3-1)13-11-6-8-14-9-7-12(11)15-16-13/h1-5,14H,6-9H2,(H,15,16) |
| InChIKey | CWCOSSAMGYKZCU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |