About N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride
N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride (PubChem CID 121209240) has the molecular formula C6H12Cl2N4S
and a molecular weight of 243.16 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride |
| PubChem CID | 121209240 |
| Molecular Formula | C6H12Cl2N4S |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride |
| SMILES | Cl.Cl.c1nsnc1NC1CCNC1 |
| InChI | InChI=1S/C6H10N4S.2ClH/c1-2-7-3-5(1)9-6-4-8-11-10-6;;/h4-5,7H,1-3H2,(H,9,10);2*1H |
| InChIKey | USYMBSXEKKZLEA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride?
The IUPAC name of N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride (CID 121209240) is N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride.
What is the SMILES notation for N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride?
The canonical SMILES for N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride is Cl.Cl.c1nsnc1NC1CCNC1.
What is the InChIKey of N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride?
The InChIKey is USYMBSXEKKZLEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4S.2ClH/c1-2-7-3-5(1)9-6-4-8-11-10-6;;/h4-5,7H,1-3H2,(H,9,10);2*1H.
What are the key properties of N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride?
N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride has a molecular weight of 243.16 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrrolidin-3-yl-1,2,5-thiadiazol-3-amine;dihydrochloride is sourced from PubChem (CID 121209240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).