C11H12N4 — CID 121209415
1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene-9-carboximidamide (PubChem CID 121209415) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene-9-carboximidamide.
| Compound Name | 1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene-9-carboximidamide |
|---|---|
| PubChem CID | 121209415 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene-9-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccn2c3c(nc12)CCC3 |
| InChI | InChI=1S/C11H12N4/c12-10(13)7-3-2-6-15-9-5-1-4-8(9)14-11(7)15/h2-3,6H,1,4-5H2,(H3,12,13) |
| InChIKey | LETJEKICFCZVGO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|