C11H12FN3 — CID 121209842
2-(3-aminoazetidin-1-yl)-2-(2-fluorophenyl)acetonitrile (PubChem CID 121209842) has the molecular formula C11H12FN3 and a molecular weight of 205.24 g/mol. Its IUPAC name is 2-(3-aminoazetidin-1-yl)-2-(2-fluorophenyl)acetonitrile.
| Compound Name | 2-(3-aminoazetidin-1-yl)-2-(2-fluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 121209842 |
| Molecular Formula | C11H12FN3 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 2-(3-aminoazetidin-1-yl)-2-(2-fluorophenyl)acetonitrile |
| SMILES | N#CC(c1ccccc1F)N1CC(N)C1 |
| InChI | InChI=1S/C11H12FN3/c12-10-4-2-1-3-9(10)11(5-13)15-6-8(14)7-15/h1-4,8,11H,6-7,14H2 |
| InChIKey | XBVOGWHUPFBICL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |