About 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide
5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide (PubChem CID 121210075) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide.
Molecular Properties
| Compound Name | 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide |
| PubChem CID | 121210075 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide |
| SMILES | CN(C)c1ccc(/C(N)=N/O)o1 |
| InChI | InChI=1S/C7H11N3O2/c1-10(2)6-4-3-5(12-6)7(8)9-11/h3-4,11H,1-2H3,(H2,8,9) |
| InChIKey | NELGHCOPKCXIOF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide?
The IUPAC name of 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide (CID 121210075) is 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide.
What is the SMILES notation for 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide?
The canonical SMILES for 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide is CN(C)c1ccc(/C(N)=N/O)o1.
What is the InChIKey of 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide?
The InChIKey is NELGHCOPKCXIOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-10(2)6-4-3-5(12-6)7(8)9-11/h3-4,11H,1-2H3,(H2,8,9).
What are the key properties of 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide?
5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide has a molecular weight of 169.18 g/mol, XLogP of 0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-N'-hydroxyfuran-2-carboximidamide is sourced from PubChem (CID 121210075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).