C8H9F3N2O2 — CID 121210591
methyl 1-ethyl-3-(trifluoromethyl)pyrazole-5-carboxylate (PubChem CID 121210591) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is methyl 1-ethyl-3-(trifluoromethyl)pyrazole-5-carboxylate.
| Compound Name | methyl 1-ethyl-3-(trifluoromethyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 121210591 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | methyl 1-ethyl-3-(trifluoromethyl)pyrazole-5-carboxylate |
| SMILES | CCn1nc(C(F)(F)F)cc1C(=O)OC |
| InChI | InChI=1S/C8H9F3N2O2/c1-3-13-5(7(14)15-2)4-6(12-13)8(9,10)11/h4H,3H2,1-2H3 |
| InChIKey | PLGQKJBCMDNPIQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |