C10H10N2O3S — CID 121211165
1-(2-hydroxyethyl)-3-thiophen-3-ylpyrazole-5-carboxylic acid (PubChem CID 121211165) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-thiophen-3-ylpyrazole-5-carboxylic acid.
| Compound Name | 1-(2-hydroxyethyl)-3-thiophen-3-ylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 121211165 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-thiophen-3-ylpyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccsc2)nn1CCO |
| InChI | InChI=1S/C10H10N2O3S/c13-3-2-12-9(10(14)15)5-8(11-12)7-1-4-16-6-7/h1,4-6,13H,2-3H2,(H,14,15) |
| InChIKey | SGVVAMMYSBQUJA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |