C7H9N3 — CID 121212043
3-(5-methyl-1H-pyrazol-4-yl)propanenitrile (PubChem CID 121212043) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 3-(5-methyl-1H-pyrazol-4-yl)propanenitrile.
| Compound Name | 3-(5-methyl-1H-pyrazol-4-yl)propanenitrile |
|---|---|
| PubChem CID | 121212043 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 3-(5-methyl-1H-pyrazol-4-yl)propanenitrile |
| SMILES | Cc1[nH]ncc1CCC#N |
| InChI | InChI=1S/C7H9N3/c1-6-7(3-2-4-8)5-9-10-6/h5H,2-3H2,1H3,(H,9,10) |
| InChIKey | LHCKAIHYIHRQQV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |