About 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile
3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile (PubChem CID 121213114) has the molecular formula C12H19N3
and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile |
| PubChem CID | 121213114 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile |
| SMILES | CC(C)c1n[nH]c(C(C)C)c1CCC#N |
| InChI | InChI=1S/C12H19N3/c1-8(2)11-10(6-5-7-13)12(9(3)4)15-14-11/h8-9H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | SIMQGQRZMIRTDO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile?
The IUPAC name of 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile (CID 121213114) is 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile.
What is the SMILES notation for 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile?
The canonical SMILES for 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile is CC(C)c1n[nH]c(C(C)C)c1CCC#N.
What is the InChIKey of 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile?
The InChIKey is SIMQGQRZMIRTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-8(2)11-10(6-5-7-13)12(9(3)4)15-14-11/h8-9H,5-6H2,1-4H3,(H,14,15).
What are the key properties of 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile?
3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile has a molecular weight of 205.30 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]propanenitrile is sourced from PubChem (CID 121213114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).