C13H21N3 — CID 121213156
2-[3,5-di(cyclobutyl)-1H-pyrazol-4-yl]ethanamine (PubChem CID 121213156) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-[3,5-di(cyclobutyl)-1H-pyrazol-4-yl]ethanamine.
| Compound Name | 2-[3,5-di(cyclobutyl)-1H-pyrazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 121213156 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-[3,5-di(cyclobutyl)-1H-pyrazol-4-yl]ethanamine |
| SMILES | NCCc1c(C2CCC2)n[nH]c1C1CCC1 |
| InChI | InChI=1S/C13H21N3/c14-8-7-11-12(9-3-1-4-9)15-16-13(11)10-5-2-6-10/h9-10H,1-8,14H2,(H,15,16) |
| InChIKey | GPERTSNBYHHMNQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |