methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate

C8H12N2O3 — CID 121214207

IUPACmethyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate
SMILESCOC(=O)C(C)n1[nH]c(C)cc1=O
InChIInChI=1S/C8H12N2O3/c1-5-4-7(11)10(9-5)6(2)8(12)13-3/h4,6,9H,1-3H3
InChIKeyRMMFGRMYTQFPAJ-UHFFFAOYSA-N
MW184.19 g/mol
LogP0.22
Rot. Bonds2

About methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate

methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate (PubChem CID 121214207) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate
PubChem CID121214207
Molecular FormulaC8H12N2O3
Molecular Weight184.19 g/mol
Exact Mass184.08
IUPAC Namemethyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate
SMILESCOC(=O)C(C)n1[nH]c(C)cc1=O
InChIInChI=1S/C8H12N2O3/c1-5-4-7(11)10(9-5)6(2)8(12)13-3/h4,6,9H,1-3H3
InChIKeyRMMFGRMYTQFPAJ-UHFFFAOYSA-N
XLogP0.22
TPSA64.09 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 50.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate?
The IUPAC name of methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate (CID 121214207) is methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate.
What is the SMILES notation for methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate?
The canonical SMILES for methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate is COC(=O)C(C)n1[nH]c(C)cc1=O.
What is the InChIKey of methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate?
The InChIKey is RMMFGRMYTQFPAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-5-4-7(11)10(9-5)6(2)8(12)13-3/h4,6,9H,1-3H3.
What are the key properties of methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate?
methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate has a molecular weight of 184.19 g/mol, XLogP of 0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-methyl-3-oxo-1H-pyrazol-2-yl)propanoate is sourced from PubChem (CID 121214207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).