About [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine
[2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine (PubChem CID 121214351) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine.
Molecular Properties
| Compound Name | [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine |
| PubChem CID | 121214351 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine |
| SMILES | NCc1c2c(nn1CC1CC1)CCC2 |
| InChI | InChI=1S/C11H17N3/c12-6-11-9-2-1-3-10(9)13-14(11)7-8-4-5-8/h8H,1-7,12H2 |
| InChIKey | ONKYXOXEGIORTC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine?
The IUPAC name of [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine (CID 121214351) is [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine.
What is the SMILES notation for [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine?
The canonical SMILES for [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine is NCc1c2c(nn1CC1CC1)CCC2.
What is the InChIKey of [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine?
The InChIKey is ONKYXOXEGIORTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c12-6-11-9-2-1-3-10(9)13-14(11)7-8-4-5-8/h8H,1-7,12H2.
What are the key properties of [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine?
[2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine has a molecular weight of 191.28 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclopropylmethyl)-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl]methanamine is sourced from PubChem (CID 121214351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).