About 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole
3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole (PubChem CID 121214384) has the molecular formula C10H15ClN2
and a molecular weight of 198.70 g/mol. Its IUPAC name is 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole.
Molecular Properties
| Compound Name | 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole |
| PubChem CID | 121214384 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole |
| SMILES | CCn1nc2c(c1CCl)CCCC2 |
| InChI | InChI=1S/C10H15ClN2/c1-2-13-10(7-11)8-5-3-4-6-9(8)12-13/h2-7H2,1H3 |
| InChIKey | NCAPCIBZOFPEKN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole?
The IUPAC name of 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole (CID 121214384) is 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole.
What is the SMILES notation for 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole?
The canonical SMILES for 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole is CCn1nc2c(c1CCl)CCCC2.
What is the InChIKey of 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole?
The InChIKey is NCAPCIBZOFPEKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2/c1-2-13-10(7-11)8-5-3-4-6-9(8)12-13/h2-7H2,1H3.
What are the key properties of 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole?
3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole has a molecular weight of 198.70 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-2-ethyl-4,5,6,7-tetrahydroindazole is sourced from PubChem (CID 121214384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).