About 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide
2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide (PubChem CID 121214432) has the molecular formula C9H14N4O
and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide.
Molecular Properties
| Compound Name | 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide |
| PubChem CID | 121214432 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c2c(nn1CC)CCOC2 |
| InChI | InChI=1S/C9H14N4O/c1-2-13-8(9(10)11)6-5-14-4-3-7(6)12-13/h2-5H2,1H3,(H3,10,11) |
| InChIKey | IJEXCSXOHCLGOE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide?
The IUPAC name of 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide (CID 121214432) is 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide.
What is the SMILES notation for 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide?
The canonical SMILES for 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide is [H]/N=C(\N)c1c2c(nn1CC)CCOC2.
What is the InChIKey of 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide?
The InChIKey is IJEXCSXOHCLGOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O/c1-2-13-8(9(10)11)6-5-14-4-3-7(6)12-13/h2-5H2,1H3,(H3,10,11).
What are the key properties of 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide?
2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide has a molecular weight of 194.24 g/mol, XLogP of 0.26, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboximidamide is sourced from PubChem (CID 121214432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).