C13H15ClN2S — CID 121214628
1-(2-chloroethyl)-3-thiophen-2-yl-4,5,6,7-tetrahydroindazole (PubChem CID 121214628) has the molecular formula C13H15ClN2S and a molecular weight of 266.80 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-thiophen-2-yl-4,5,6,7-tetrahydroindazole.
| Compound Name | 1-(2-chloroethyl)-3-thiophen-2-yl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 121214628 |
| Molecular Formula | C13H15ClN2S |
| Molecular Weight | 266.80 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1-(2-chloroethyl)-3-thiophen-2-yl-4,5,6,7-tetrahydroindazole |
| SMILES | ClCCn1nc(-c2cccs2)c2c1CCCC2 |
| InChI | InChI=1S/C13H15ClN2S/c14-7-8-16-11-5-2-1-4-10(11)13(15-16)12-6-3-9-17-12/h3,6,9H,1-2,4-5,7-8H2 |
| InChIKey | MSFNZSGPLNDAEY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.80 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|