About 1-ethyl-6-methylimidazo[1,2-b]pyrazole
1-ethyl-6-methylimidazo[1,2-b]pyrazole (PubChem CID 121214767) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 1-ethyl-6-methylimidazo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 1-ethyl-6-methylimidazo[1,2-b]pyrazole |
| PubChem CID | 121214767 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1-ethyl-6-methylimidazo[1,2-b]pyrazole |
| SMILES | CCn1ccn2nc(C)cc12 |
| InChI | InChI=1S/C8H11N3/c1-3-10-4-5-11-8(10)6-7(2)9-11/h4-6H,3H2,1-2H3 |
| InChIKey | UMEOOGDBPMGTHS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-6-methylimidazo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-6-methylimidazo[1,2-b]pyrazole?
The IUPAC name of 1-ethyl-6-methylimidazo[1,2-b]pyrazole (CID 121214767) is 1-ethyl-6-methylimidazo[1,2-b]pyrazole.
What is the SMILES notation for 1-ethyl-6-methylimidazo[1,2-b]pyrazole?
The canonical SMILES for 1-ethyl-6-methylimidazo[1,2-b]pyrazole is CCn1ccn2nc(C)cc12.
What is the InChIKey of 1-ethyl-6-methylimidazo[1,2-b]pyrazole?
The InChIKey is UMEOOGDBPMGTHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-3-10-4-5-11-8(10)6-7(2)9-11/h4-6H,3H2,1-2H3.
What are the key properties of 1-ethyl-6-methylimidazo[1,2-b]pyrazole?
1-ethyl-6-methylimidazo[1,2-b]pyrazole has a molecular weight of 149.20 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-6-methylimidazo[1,2-b]pyrazole is sourced from PubChem (CID 121214767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).