About 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine
3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine (PubChem CID 121214860) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine |
| PubChem CID | 121214860 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine |
| SMILES | NCCCn1ccn2nc(C3CCC3)cc12 |
| InChI | InChI=1S/C12H18N4/c13-5-2-6-15-7-8-16-12(15)9-11(14-16)10-3-1-4-10/h7-10H,1-6,13H2 |
| InChIKey | AEMHGEALSHNVQC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 48.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine?
The IUPAC name of 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine (CID 121214860) is 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine.
What is the SMILES notation for 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine?
The canonical SMILES for 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine is NCCCn1ccn2nc(C3CCC3)cc12.
What is the InChIKey of 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine?
The InChIKey is AEMHGEALSHNVQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c13-5-2-6-15-7-8-16-12(15)9-11(14-16)10-3-1-4-10/h7-10H,1-6,13H2.
What are the key properties of 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine?
3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine has a molecular weight of 218.30 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-cyclobutylimidazo[2,1-e]pyrazol-1-yl)propan-1-amine is sourced from PubChem (CID 121214860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).