About 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol
2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol (PubChem CID 121214931) has the molecular formula C11H11N5O
and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol |
| PubChem CID | 121214931 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol |
| SMILES | OCCn1ccn2nc(-c3cnccn3)cc12 |
| InChI | InChI=1S/C11H11N5O/c17-6-5-15-3-4-16-11(15)7-9(14-16)10-8-12-1-2-13-10/h1-4,7-8,17H,5-6H2 |
| InChIKey | CSAOTYIDHHDZKO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol?
The IUPAC name of 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol (CID 121214931) is 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol.
What is the SMILES notation for 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol?
The canonical SMILES for 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol is OCCn1ccn2nc(-c3cnccn3)cc12.
What is the InChIKey of 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol?
The InChIKey is CSAOTYIDHHDZKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5O/c17-6-5-15-3-4-16-11(15)7-9(14-16)10-8-12-1-2-13-10/h1-4,7-8,17H,5-6H2.
What are the key properties of 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol?
2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol has a molecular weight of 229.24 g/mol, XLogP of 0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-pyrazin-2-ylimidazo[2,1-e]pyrazol-1-yl)ethanol is sourced from PubChem (CID 121214931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).