About 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole
1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole (PubChem CID 121214989) has the molecular formula C8H8F3N3
and a molecular weight of 203.17 g/mol. Its IUPAC name is 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole.
Molecular Properties
| Compound Name | 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole |
| PubChem CID | 121214989 |
| Molecular Formula | C8H8F3N3 |
| Molecular Weight | 203.17 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole |
| SMILES | CCn1ccn2nc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C8H8F3N3/c1-2-13-3-4-14-7(13)5-6(12-14)8(9,10)11/h3-5H,2H2,1H3 |
| InChIKey | WAXOUMPFULMJEX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole?
The IUPAC name of 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole (CID 121214989) is 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole.
What is the SMILES notation for 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole?
The canonical SMILES for 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole is CCn1ccn2nc(C(F)(F)F)cc12.
What is the InChIKey of 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole?
The InChIKey is WAXOUMPFULMJEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3/c1-2-13-3-4-14-7(13)5-6(12-14)8(9,10)11/h3-5H,2H2,1H3.
What are the key properties of 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole?
1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole has a molecular weight of 203.17 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-6-(trifluoromethyl)imidazo[2,1-e]pyrazole is sourced from PubChem (CID 121214989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).