About 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol
2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol (PubChem CID 121214996) has the molecular formula C8H8F3N3O
and a molecular weight of 219.17 g/mol. Its IUPAC name is 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol |
| PubChem CID | 121214996 |
| Molecular Formula | C8H8F3N3O |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol |
| SMILES | OCCn1ccn2nc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C8H8F3N3O/c9-8(10,11)6-5-7-13(3-4-15)1-2-14(7)12-6/h1-2,5,15H,3-4H2 |
| InChIKey | OYQCPZWTUMSWEI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 42.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol?
The IUPAC name of 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol (CID 121214996) is 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol.
What is the SMILES notation for 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol?
The canonical SMILES for 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol is OCCn1ccn2nc(C(F)(F)F)cc12.
What is the InChIKey of 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol?
The InChIKey is OYQCPZWTUMSWEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3O/c9-8(10,11)6-5-7-13(3-4-15)1-2-14(7)12-6/h1-2,5,15H,3-4H2.
What are the key properties of 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol?
2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol has a molecular weight of 219.17 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(trifluoromethyl)imidazo[2,1-e]pyrazol-1-yl]ethanol is sourced from PubChem (CID 121214996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).