About 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole
7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole (PubChem CID 121215112) has the molecular formula C7H8ClN3
and a molecular weight of 169.61 g/mol. Its IUPAC name is 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole.
Molecular Properties
| Compound Name | 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole |
| PubChem CID | 121215112 |
| Molecular Formula | C7H8ClN3 |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole |
| SMILES | Cn1ccn2ncc(CCl)c12 |
| InChI | InChI=1S/C7H8ClN3/c1-10-2-3-11-7(10)6(4-8)5-9-11/h2-3,5H,4H2,1H3 |
| InChIKey | PEAYUVWEDJFKQS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole?
The IUPAC name of 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole (CID 121215112) is 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole.
What is the SMILES notation for 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole?
The canonical SMILES for 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole is Cn1ccn2ncc(CCl)c12.
What is the InChIKey of 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole?
The InChIKey is PEAYUVWEDJFKQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN3/c1-10-2-3-11-7(10)6(4-8)5-9-11/h2-3,5H,4H2,1H3.
What are the key properties of 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole?
7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole has a molecular weight of 169.61 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(chloromethyl)-1-methylimidazo[2,1-e]pyrazole is sourced from PubChem (CID 121215112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).