About 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole
1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole (PubChem CID 121215146) has the molecular formula C11H10N4
and a molecular weight of 198.23 g/mol. Its IUPAC name is 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole.
Molecular Properties
| Compound Name | 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole |
| PubChem CID | 121215146 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole |
| SMILES | Cn1ccn2ncc(-c3ccncc3)c12 |
| InChI | InChI=1S/C11H10N4/c1-14-6-7-15-11(14)10(8-13-15)9-2-4-12-5-3-9/h2-8H,1H3 |
| InChIKey | IUUYIXCJWJBLEC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole?
The IUPAC name of 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole (CID 121215146) is 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole.
What is the SMILES notation for 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole?
The canonical SMILES for 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole is Cn1ccn2ncc(-c3ccncc3)c12.
What is the InChIKey of 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole?
The InChIKey is IUUYIXCJWJBLEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4/c1-14-6-7-15-11(14)10(8-13-15)9-2-4-12-5-3-9/h2-8H,1H3.
What are the key properties of 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole?
1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole has a molecular weight of 198.23 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-pyridin-4-ylimidazo[2,1-e]pyrazole is sourced from PubChem (CID 121215146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).