About (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol
(6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol (PubChem CID 121215294) has the molecular formula C12H11N3O
and a molecular weight of 213.24 g/mol. Its IUPAC name is (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol.
Molecular Properties
| Compound Name | (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol |
| PubChem CID | 121215294 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol |
| SMILES | OCc1c(-c2ccccc2)[nH]n2ccnc12 |
| InChI | InChI=1S/C12H11N3O/c16-8-10-11(9-4-2-1-3-5-9)14-15-7-6-13-12(10)15/h1-7,14,16H,8H2 |
| InChIKey | ZTNGYNTXOXIRAX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol?
The IUPAC name of (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol (CID 121215294) is (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol.
What is the SMILES notation for (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol?
The canonical SMILES for (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol is OCc1c(-c2ccccc2)[nH]n2ccnc12.
What is the InChIKey of (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol?
The InChIKey is ZTNGYNTXOXIRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O/c16-8-10-11(9-4-2-1-3-5-9)14-15-7-6-13-12(10)15/h1-7,14,16H,8H2.
What are the key properties of (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol?
(6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol has a molecular weight of 213.24 g/mol, XLogP of 1.82, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-phenyl-5H-imidazo[1,2-b]pyrazol-7-yl)methanol is sourced from PubChem (CID 121215294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).