C7H9ClN2O — CID 121215428
3-(chloromethyl)-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole (PubChem CID 121215428) has the molecular formula C7H9ClN2O and a molecular weight of 172.61 g/mol. Its IUPAC name is 3-(chloromethyl)-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole.
| Compound Name | 3-(chloromethyl)-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole |
|---|---|
| PubChem CID | 121215428 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 3-(chloromethyl)-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole |
| SMILES | ClCc1n[nH]c2c1COCC2 |
| InChI | InChI=1S/C7H9ClN2O/c8-3-7-5-4-11-2-1-6(5)9-10-7/h1-4H2,(H,9,10) |
| InChIKey | XVVHGWMQZXSNFR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|