C10H8N6O2 — CID 121215796
5-methyl-9-nitro-[1,2,4]triazolo[1,5-c]quinazolin-2-amine (PubChem CID 121215796) has the molecular formula C10H8N6O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 5-methyl-9-nitro-[1,2,4]triazolo[1,5-c]quinazolin-2-amine.
| Compound Name | 5-methyl-9-nitro-[1,2,4]triazolo[1,5-c]quinazolin-2-amine |
|---|---|
| PubChem CID | 121215796 |
| Molecular Formula | C10H8N6O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 5-methyl-9-nitro-[1,2,4]triazolo[1,5-c]quinazolin-2-amine |
| SMILES | Cc1nc2ccc([N+](=O)[O-])cc2c2nc(N)nn12 |
| InChI | InChI=1S/C10H8N6O2/c1-5-12-8-3-2-6(16(17)18)4-7(8)9-13-10(11)14-15(5)9/h2-4H,1H3,(H2,11,14) |
| InChIKey | NPNJURPIWNWVBF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|