About (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine
(E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 121216346) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
Molecular Properties
| Compound Name | (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| PubChem CID | 121216346 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | CO/N=C1\CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C11H19NO/c1-10(2)8-5-6-11(10,3)9(7-8)12-13-4/h8H,5-7H2,1-4H3/b12-9+ |
| InChIKey | WGUFMRSWXMTFJZ-FMIVXFBMSA-N |
| XLogP | 2.84 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine?
The IUPAC name of (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (CID 121216346) is (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
What is the SMILES notation for (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine?
The canonical SMILES for (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine is CO/N=C1\CC2CCC1(C)C2(C)C.
What is the InChIKey of (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine?
The InChIKey is WGUFMRSWXMTFJZ-FMIVXFBMSA-N. The full InChI is InChI=1S/C11H19NO/c1-10(2)8-5-6-11(10,3)9(7-8)12-13-4/h8H,5-7H2,1-4H3/b12-9+.
What are the key properties of (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine?
(E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine has a molecular weight of 181.28 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine is sourced from PubChem (CID 121216346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).