C11H14N6O4 — CID 121217181
[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]urea (PubChem CID 121217181) has the molecular formula C11H14N6O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is [9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]urea.
| Compound Name | [9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]urea |
|---|---|
| PubChem CID | 121217181 |
| Molecular Formula | C11H14N6O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | [9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]urea |
| SMILES | NC(=O)Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C11H14N6O4/c12-11(20)16-9-8-10(14-3-13-9)17(4-15-8)7-1-5(19)6(2-18)21-7/h3-7,18-19H,1-2H2,(H3,12,13,14,16,20)/t5-,6+,7+/m0/s1 |
| InChIKey | IZLZBKAFSJPZDM-RRKCRQDMSA-N |
| XLogP | -1.04 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |