C11H14O2 — CID 121219869
2-methyl-4,5,8,8b-tetrahydro-3aH-indeno[1,2-d][1,3]dioxole (PubChem CID 121219869) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-methyl-4,5,8,8b-tetrahydro-3aH-indeno[1,2-d][1,3]dioxole.
| Compound Name | 2-methyl-4,5,8,8b-tetrahydro-3aH-indeno[1,2-d][1,3]dioxole |
|---|---|
| PubChem CID | 121219869 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-methyl-4,5,8,8b-tetrahydro-3aH-indeno[1,2-d][1,3]dioxole |
| SMILES | CC1OC2CC3=C(CC=CC3)C2O1 |
| InChI | InChI=1S/C11H14O2/c1-7-12-10-6-8-4-2-3-5-9(8)11(10)13-7/h2-3,7,10-11H,4-6H2,1H3 |
| InChIKey | BXGUHOVNSZYRLX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|