About 4-cyclopropyl-2,3-benzoxazin-1-one
4-cyclopropyl-2,3-benzoxazin-1-one (PubChem CID 121219899) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-cyclopropyl-2,3-benzoxazin-1-one.
Molecular Properties
| Compound Name | 4-cyclopropyl-2,3-benzoxazin-1-one |
| PubChem CID | 121219899 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 4-cyclopropyl-2,3-benzoxazin-1-one |
| SMILES | O=c1onc(C2CC2)c2ccccc12 |
| InChI | InChI=1S/C11H9NO2/c13-11-9-4-2-1-3-8(9)10(12-14-11)7-5-6-7/h1-4,7H,5-6H2 |
| InChIKey | CBCSVNIIAZRWKS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclopropyl-2,3-benzoxazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-2,3-benzoxazin-1-one?
The IUPAC name of 4-cyclopropyl-2,3-benzoxazin-1-one (CID 121219899) is 4-cyclopropyl-2,3-benzoxazin-1-one.
What is the SMILES notation for 4-cyclopropyl-2,3-benzoxazin-1-one?
The canonical SMILES for 4-cyclopropyl-2,3-benzoxazin-1-one is O=c1onc(C2CC2)c2ccccc12.
What is the InChIKey of 4-cyclopropyl-2,3-benzoxazin-1-one?
The InChIKey is CBCSVNIIAZRWKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c13-11-9-4-2-1-3-8(9)10(12-14-11)7-5-6-7/h1-4,7H,5-6H2.
What are the key properties of 4-cyclopropyl-2,3-benzoxazin-1-one?
4-cyclopropyl-2,3-benzoxazin-1-one has a molecular weight of 187.20 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-2,3-benzoxazin-1-one is sourced from PubChem (CID 121219899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).