C11H17NO — CID 121220899
2-methyl-2-azatricyclo[5.3.1.03,8]undecan-4-one (PubChem CID 121220899) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-methyl-2-azatricyclo[5.3.1.03,8]undecan-4-one.
| Compound Name | 2-methyl-2-azatricyclo[5.3.1.03,8]undecan-4-one |
|---|---|
| PubChem CID | 121220899 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-methyl-2-azatricyclo[5.3.1.03,8]undecan-4-one |
| SMILES | CN1C2CCC3C(CCC(=O)C31)C2 |
| InChI | InChI=1S/C11H17NO/c1-12-8-3-4-9-7(6-8)2-5-10(13)11(9)12/h7-9,11H,2-6H2,1H3 |
| InChIKey | ZEKFUBFWWOIYCF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |