About 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one
3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one (PubChem CID 121221008) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one.
Molecular Properties
| Compound Name | 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one |
| PubChem CID | 121221008 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one |
| SMILES | CC(=O)c1c(O)c2c(oc1=O)CCCC2 |
| InChI | InChI=1S/C11H12O4/c1-6(12)9-10(13)7-4-2-3-5-8(7)15-11(9)14/h13H,2-5H2,1H3 |
| InChIKey | MZZBJKCJKAVKBF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one?
The IUPAC name of 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one (CID 121221008) is 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one.
What is the SMILES notation for 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one?
The canonical SMILES for 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one is CC(=O)c1c(O)c2c(oc1=O)CCCC2.
What is the InChIKey of 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one?
The InChIKey is MZZBJKCJKAVKBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-6(12)9-10(13)7-4-2-3-5-8(7)15-11(9)14/h13H,2-5H2,1H3.
What are the key properties of 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one?
3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one has a molecular weight of 208.21 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-4-hydroxy-5,6,7,8-tetrahydrochromen-2-one is sourced from PubChem (CID 121221008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).