About 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one
2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one (PubChem CID 121221634) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one.
Molecular Properties
| Compound Name | 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one |
| PubChem CID | 121221634 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one |
| SMILES | C=CC(C)(CCC(=O)C(C)(C)O)OC |
| InChI | InChI=1S/C11H20O3/c1-6-11(4,14-5)8-7-9(12)10(2,3)13/h6,13H,1,7-8H2,2-5H3 |
| InChIKey | AZADGRIBMCHLGA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one?
The IUPAC name of 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one (CID 121221634) is 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one.
What is the SMILES notation for 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one?
The canonical SMILES for 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one is C=CC(C)(CCC(=O)C(C)(C)O)OC.
What is the InChIKey of 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one?
The InChIKey is AZADGRIBMCHLGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-6-11(4,14-5)8-7-9(12)10(2,3)13/h6,13H,1,7-8H2,2-5H3.
What are the key properties of 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one?
2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one has a molecular weight of 200.28 g/mol, XLogP of 1.70, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-6-methoxy-2,6-dimethyloct-7-en-3-one is sourced from PubChem (CID 121221634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).