About 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile
5-fluoro-3,4-dihydronaphthalene-1-carbonitrile (PubChem CID 121221897) has the molecular formula C11H8FN
and a molecular weight of 173.19 g/mol. Its IUPAC name is 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile.
Molecular Properties
| Compound Name | 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile |
| PubChem CID | 121221897 |
| Molecular Formula | C11H8FN |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile |
| SMILES | N#CC1=CCCc2c(F)cccc21 |
| InChI | InChI=1S/C11H8FN/c12-11-6-2-4-9-8(7-13)3-1-5-10(9)11/h2-4,6H,1,5H2 |
| InChIKey | SKLSIZPTMGQTGI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile?
The IUPAC name of 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile (CID 121221897) is 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile.
What is the SMILES notation for 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile?
The canonical SMILES for 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile is N#CC1=CCCc2c(F)cccc21.
What is the InChIKey of 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile?
The InChIKey is SKLSIZPTMGQTGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FN/c12-11-6-2-4-9-8(7-13)3-1-5-10(9)11/h2-4,6H,1,5H2.
What are the key properties of 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile?
5-fluoro-3,4-dihydronaphthalene-1-carbonitrile has a molecular weight of 173.19 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3,4-dihydronaphthalene-1-carbonitrile is sourced from PubChem (CID 121221897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).