About 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone
1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone (PubChem CID 121223230) has the molecular formula C11H8N4O2
and a molecular weight of 228.21 g/mol. Its IUPAC name is 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone |
| PubChem CID | 121223230 |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone |
| SMILES | CC(=O)n1nnc2c(-c3ccccc3)noc21 |
| InChI | InChI=1S/C11H8N4O2/c1-7(16)15-11-10(12-14-15)9(13-17-11)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | WRLRJTFWFLTKKI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone?
The IUPAC name of 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone (CID 121223230) is 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone.
What is the SMILES notation for 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone?
The canonical SMILES for 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone is CC(=O)n1nnc2c(-c3ccccc3)noc21.
What is the InChIKey of 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone?
The InChIKey is WRLRJTFWFLTKKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O2/c1-7(16)15-11-10(12-14-15)9(13-17-11)8-5-3-2-4-6-8/h2-6H,1H3.
What are the key properties of 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone?
1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone has a molecular weight of 228.21 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-phenyl-[1,2]oxazolo[4,5-d]triazol-3-yl)ethanone is sourced from PubChem (CID 121223230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).