About methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone
methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone (PubChem CID 121223244) has the molecular formula C11H18OS2
and a molecular weight of 230.40 g/mol. Its IUPAC name is methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone.
Molecular Properties
| Compound Name | methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone |
| PubChem CID | 121223244 |
| Molecular Formula | C11H18OS2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone |
| SMILES | CSC(=O)SC1C=C(C)CC(C)(C)C1 |
| InChI | InChI=1S/C11H18OS2/c1-8-5-9(14-10(12)13-4)7-11(2,3)6-8/h5,9H,6-7H2,1-4H3 |
| InChIKey | JMIUOPMBYYDHFM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone?
The IUPAC name of methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone (CID 121223244) is methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone.
What is the SMILES notation for methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone?
The canonical SMILES for methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone is CSC(=O)SC1C=C(C)CC(C)(C)C1.
What is the InChIKey of methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone?
The InChIKey is JMIUOPMBYYDHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18OS2/c1-8-5-9(14-10(12)13-4)7-11(2,3)6-8/h5,9H,6-7H2,1-4H3.
What are the key properties of methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone?
methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone has a molecular weight of 230.40 g/mol, XLogP of 4.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanyl-(3,5,5-trimethylcyclohex-2-en-1-yl)sulfanylmethanone is sourced from PubChem (CID 121223244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).