About 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole
2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole (PubChem CID 121223328) has the molecular formula C11H19NO2S2
and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole |
| PubChem CID | 121223328 |
| Molecular Formula | C11H19NO2S2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole |
| SMILES | CCOC(CSc1nc(C)c(C)s1)OCC |
| InChI | InChI=1S/C11H19NO2S2/c1-5-13-10(14-6-2)7-15-11-12-8(3)9(4)16-11/h10H,5-7H2,1-4H3 |
| InChIKey | RUJUNSXFULEMAH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole?
The IUPAC name of 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole (CID 121223328) is 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole.
What is the SMILES notation for 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole?
The canonical SMILES for 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole is CCOC(CSc1nc(C)c(C)s1)OCC.
What is the InChIKey of 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole?
The InChIKey is RUJUNSXFULEMAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2S2/c1-5-13-10(14-6-2)7-15-11-12-8(3)9(4)16-11/h10H,5-7H2,1-4H3.
What are the key properties of 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole?
2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole has a molecular weight of 261.41 g/mol, XLogP of 3.25, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diethoxyethylsulfanyl)-4,5-dimethyl-1,3-thiazole is sourced from PubChem (CID 121223328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).