C11H10FNO — CID 121223710
6-fluoro-2,3,3a,4-tetrahydropyrrolo[1,2-a]indol-1-one (PubChem CID 121223710) has the molecular formula C11H10FNO and a molecular weight of 191.21 g/mol. Its IUPAC name is 6-fluoro-2,3,3a,4-tetrahydropyrrolo[1,2-a]indol-1-one.
| Compound Name | 6-fluoro-2,3,3a,4-tetrahydropyrrolo[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 121223710 |
| Molecular Formula | C11H10FNO |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 6-fluoro-2,3,3a,4-tetrahydropyrrolo[1,2-a]indol-1-one |
| SMILES | O=C1CCC2Cc3cc(F)ccc3N12 |
| InChI | InChI=1S/C11H10FNO/c12-8-1-3-10-7(5-8)6-9-2-4-11(14)13(9)10/h1,3,5,9H,2,4,6H2 |
| InChIKey | SBBWWWMQTUEDCM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |