C11H12N4O4 — CID 121223894
2-(2,4-dinitrophenyl)-5-ethyl-3,4-dihydropyrazole (PubChem CID 121223894) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-5-ethyl-3,4-dihydropyrazole.
| Compound Name | 2-(2,4-dinitrophenyl)-5-ethyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 121223894 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-5-ethyl-3,4-dihydropyrazole |
| SMILES | CCC1=NN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C11H12N4O4/c1-2-8-5-6-13(12-8)10-4-3-9(14(16)17)7-11(10)15(18)19/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | DPLWNZVHVFRJGV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|