About [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate
[(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate (PubChem CID 121224175) has the molecular formula C11H12N2O5
and a molecular weight of 252.23 g/mol. Its IUPAC name is [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate.
Molecular Properties
| Compound Name | [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate |
| PubChem CID | 121224175 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate |
| SMILES | CC(=O)OCC(=O)/C=C/Cc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H12N2O5/c1-7(14)18-6-9(15)4-2-3-8-5-12-11(17)13-10(8)16/h2,4-5H,3,6H2,1H3,(H2,12,13,16,17)/b4-2+ |
| InChIKey | XIOBWCBYIURAHZ-DUXPYHPUSA-N |
| XLogP | -0.71 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate?
The IUPAC name of [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate (CID 121224175) is [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate.
What is the SMILES notation for [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate?
The canonical SMILES for [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate is CC(=O)OCC(=O)/C=C/Cc1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate?
The InChIKey is XIOBWCBYIURAHZ-DUXPYHPUSA-N. The full InChI is InChI=1S/C11H12N2O5/c1-7(14)18-6-9(15)4-2-3-8-5-12-11(17)13-10(8)16/h2,4-5H,3,6H2,1H3,(H2,12,13,16,17)/b4-2+.
What are the key properties of [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate?
[(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate has a molecular weight of 252.23 g/mol, XLogP of -0.71, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-5-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxopent-3-enyl] acetate is sourced from PubChem (CID 121224175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).