About 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride
10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride (PubChem CID 121224331) has the molecular formula C11H22ClNO
and a molecular weight of 219.76 g/mol. Its IUPAC name is 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride.
Molecular Properties
| Compound Name | 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride |
| PubChem CID | 121224331 |
| Molecular Formula | C11H22ClNO |
| Molecular Weight | 219.76 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride |
| SMILES | CC1(C)CC2(CCCNC2)CCO1.Cl |
| InChI | InChI=1S/C11H21NO.ClH/c1-10(2)8-11(5-7-13-10)4-3-6-12-9-11;/h12H,3-9H2,1-2H3;1H |
| InChIKey | FRLKIRSMXDLRQD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.76 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride?
The IUPAC name of 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride (CID 121224331) is 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride.
What is the SMILES notation for 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride?
The canonical SMILES for 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride is CC1(C)CC2(CCCNC2)CCO1.Cl.
What is the InChIKey of 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride?
The InChIKey is FRLKIRSMXDLRQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO.ClH/c1-10(2)8-11(5-7-13-10)4-3-6-12-9-11;/h12H,3-9H2,1-2H3;1H.
What are the key properties of 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride?
10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride has a molecular weight of 219.76 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane;hydrochloride is sourced from PubChem (CID 121224331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).